C16H15BrN2S2 — CID 22474228
3-(1-benzothiophen-4-yl)-2-prop-2-enyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide (PubChem CID 22474228) has the molecular formula C16H15BrN2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is 3-(1-benzothiophen-4-yl)-2-prop-2-enyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide.
| Compound Name | 3-(1-benzothiophen-4-yl)-2-prop-2-enyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide |
|---|---|
| PubChem CID | 22474228 |
| Molecular Formula | C16H15BrN2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 3-(1-benzothiophen-4-yl)-2-prop-2-enyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide |
| SMILES | Br.C=CCC1=C(c2cccc3sccc23)N2CCN=C2S1 |
| InChI | InChI=1S/C16H14N2S2.BrH/c1-2-4-14-15(18-9-8-17-16(18)20-14)12-5-3-6-13-11(12)7-10-19-13;/h2-3,5-7,10H,1,4,8-9H2;1H |
| InChIKey | XEFVWAYBYOAYAA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|