About ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate
ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 22474675) has the molecular formula C13H23N3O4
and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate |
| PubChem CID | 22474675 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(O)(CN2CCCNC2=O)CC1 |
| InChI | InChI=1S/C13H23N3O4/c1-2-20-12(18)15-8-4-13(19,5-9-15)10-16-7-3-6-14-11(16)17/h19H,2-10H2,1H3,(H,14,17) |
| InChIKey | XVVDGHWAWZXBMY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate (CID 22474675) is ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate is CCOC(=O)N1CCC(O)(CN2CCCNC2=O)CC1.
What is the InChIKey of ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate?
The InChIKey is XVVDGHWAWZXBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4/c1-2-20-12(18)15-8-4-13(19,5-9-15)10-16-7-3-6-14-11(16)17/h19H,2-10H2,1H3,(H,14,17).
What are the key properties of ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate?
ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate has a molecular weight of 285.34 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-4-[(2-oxo-1,3-diazinan-1-yl)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 22474675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).