About 3-(ethylamino)propyl prop-2-enoate;hydrochloride
3-(ethylamino)propyl prop-2-enoate;hydrochloride (PubChem CID 22475655) has the molecular formula C8H16ClNO2
and a molecular weight of 193.67 g/mol. Its IUPAC name is 3-(ethylamino)propyl prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 3-(ethylamino)propyl prop-2-enoate;hydrochloride |
| PubChem CID | 22475655 |
| Molecular Formula | C8H16ClNO2 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(ethylamino)propyl prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)OCCCNCC.Cl |
| InChI | InChI=1S/C8H15NO2.ClH/c1-3-8(10)11-7-5-6-9-4-2;/h3,9H,1,4-7H2,2H3;1H |
| InChIKey | RGBOOXGRFQQAIA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylamino)propyl prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)propyl prop-2-enoate;hydrochloride?
The IUPAC name of 3-(ethylamino)propyl prop-2-enoate;hydrochloride (CID 22475655) is 3-(ethylamino)propyl prop-2-enoate;hydrochloride.
What is the SMILES notation for 3-(ethylamino)propyl prop-2-enoate;hydrochloride?
The canonical SMILES for 3-(ethylamino)propyl prop-2-enoate;hydrochloride is C=CC(=O)OCCCNCC.Cl.
What is the InChIKey of 3-(ethylamino)propyl prop-2-enoate;hydrochloride?
The InChIKey is RGBOOXGRFQQAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.ClH/c1-3-8(10)11-7-5-6-9-4-2;/h3,9H,1,4-7H2,2H3;1H.
What are the key properties of 3-(ethylamino)propyl prop-2-enoate;hydrochloride?
3-(ethylamino)propyl prop-2-enoate;hydrochloride has a molecular weight of 193.67 g/mol, XLogP of 1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)propyl prop-2-enoate;hydrochloride is sourced from PubChem (CID 22475655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).