About 1,2-diphenylimidazolidine
1,2-diphenylimidazolidine (PubChem CID 22475925) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 1,2-diphenylimidazolidine.
Molecular Properties
| Compound Name | 1,2-diphenylimidazolidine |
| PubChem CID | 22475925 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1,2-diphenylimidazolidine |
| SMILES | c1ccc(C2NCCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | LDJFOZIAFPUDOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-diphenylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylimidazolidine?
The IUPAC name of 1,2-diphenylimidazolidine (CID 22475925) is 1,2-diphenylimidazolidine.
What is the SMILES notation for 1,2-diphenylimidazolidine?
The canonical SMILES for 1,2-diphenylimidazolidine is c1ccc(C2NCCN2c2ccccc2)cc1.
What is the InChIKey of 1,2-diphenylimidazolidine?
The InChIKey is LDJFOZIAFPUDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2.
What are the key properties of 1,2-diphenylimidazolidine?
1,2-diphenylimidazolidine has a molecular weight of 224.31 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylimidazolidine is sourced from PubChem (CID 22475925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).