C23H26ClN3 — CID 22475991
2,4-bis(4-tert-butylphenyl)-6-chloro-1,3,5-triazine (PubChem CID 22475991) has the molecular formula C23H26ClN3 and a molecular weight of 379.94 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-chloro-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-chloro-1,3,5-triazine |
|---|---|
| PubChem CID | 22475991 |
| Molecular Formula | C23H26ClN3 |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-chloro-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(Cl)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H26ClN3/c1-22(2,3)17-11-7-15(8-12-17)19-25-20(27-21(24)26-19)16-9-13-18(14-10-16)23(4,5)6/h7-14H,1-6H3 |
| InChIKey | NLAAIBGZDQFCAO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |