About tributoxy(chloro)germane
tributoxy(chloro)germane (PubChem CID 22476945) has the molecular formula C12H27ClGeO3
and a molecular weight of 327.41 g/mol. Its IUPAC name is tributoxy(chloro)germane.
Molecular Properties
| Compound Name | tributoxy(chloro)germane |
| PubChem CID | 22476945 |
| Molecular Formula | C12H27ClGeO3 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | tributoxy(chloro)germane |
| SMILES | CCCCO[Ge](Cl)(OCCCC)OCCCC |
| InChI | InChI=1S/C12H27ClGeO3/c1-4-7-10-15-14(13,16-11-8-5-2)17-12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | YSAINHRZHZBAMS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tributoxy(chloro)germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributoxy(chloro)germane?
The IUPAC name of tributoxy(chloro)germane (CID 22476945) is tributoxy(chloro)germane.
What is the SMILES notation for tributoxy(chloro)germane?
The canonical SMILES for tributoxy(chloro)germane is CCCCO[Ge](Cl)(OCCCC)OCCCC.
What is the InChIKey of tributoxy(chloro)germane?
The InChIKey is YSAINHRZHZBAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27ClGeO3/c1-4-7-10-15-14(13,16-11-8-5-2)17-12-9-6-3/h4-12H2,1-3H3.
What are the key properties of tributoxy(chloro)germane?
tributoxy(chloro)germane has a molecular weight of 327.41 g/mol, XLogP of 4.11, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributoxy(chloro)germane is sourced from PubChem (CID 22476945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).