About 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine
2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 22477349) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 22477349 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc2c(-c3cc4cccnc4[nH]3)cn(C)c2cc1OC |
| InChI | InChI=1S/C18H17N3O2/c1-21-10-13(14-7-11-5-4-6-19-18(11)20-14)12-8-16(22-2)17(23-3)9-15(12)21/h4-10H,1-3H3,(H,19,20) |
| InChIKey | GZRCWJUTTURNJO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine (CID 22477349) is 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine is COc1cc2c(-c3cc4cccnc4[nH]3)cn(C)c2cc1OC.
What is the InChIKey of 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is GZRCWJUTTURNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-21-10-13(14-7-11-5-4-6-19-18(11)20-14)12-8-16(22-2)17(23-3)9-15(12)21/h4-10H,1-3H3,(H,19,20).
What are the key properties of 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 307.35 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethoxy-1-methylindol-3-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 22477349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).