About 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid
1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid (PubChem CID 22477670) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid.
Analyze 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name of 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid (CID 22477670) is 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid.
What is the SMILES notation for 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES for 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid is O=C(O)c1n[nH]c2c1COCC2.
What is the InChIKey of 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is YICMXCDJSOOXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-7(11)6-4-3-12-2-1-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11).
What are the key properties of 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid?
1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid is sourced from PubChem (CID 22477670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).