C22H27BrClFN4O4S — CID 22478275
N-(4-bromo-2-fluorophenyl)-7-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-methoxy-1H-quinazolin-4-amine;hydrochloride (PubChem CID 22478275) has the molecular formula C22H27BrClFN4O4S and a molecular weight of 577.90 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-7-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-methoxy-1H-quinazolin-4-amine;hydrochloride.
| Compound Name | N-(4-bromo-2-fluorophenyl)-7-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-methoxy-1H-quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22478275 |
| Molecular Formula | C22H27BrClFN4O4S |
| Molecular Weight | 577.90 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-7-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-methoxy-1H-quinazolin-4-amine;hydrochloride |
| SMILES | COC1(Nc2ccc(Br)cc2F)N=CNc2cc(OCCCN3CCS(=O)(=O)CC3)ccc21.Cl |
| InChI | InChI=1S/C22H26BrFN4O4S.ClH/c1-31-22(27-20-6-3-16(23)13-19(20)24)18-5-4-17(14-21(18)25-15-26-22)32-10-2-7-28-8-11-33(29,30)12-9-28;/h3-6,13-15,27H,2,7-12H2,1H3,(H,25,26);1H |
| InChIKey | PVCSYUIHBGXIBK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|