C22H23NOS2 — CID 22478336
N,N-dimethyl-2-[(17-methyl-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]ethanamine (PubChem CID 22478336) has the molecular formula C22H23NOS2 and a molecular weight of 381.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[(17-methyl-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[(17-methyl-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]ethanamine |
|---|---|
| PubChem CID | 22478336 |
| Molecular Formula | C22H23NOS2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N,N-dimethyl-2-[(17-methyl-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]ethanamine |
| SMILES | Cc1ccc2c(c1)-c1sc(COCCN(C)C)cc1-c1ccccc1S2 |
| InChI | InChI=1S/C22H23NOS2/c1-15-8-9-21-19(12-15)22-18(17-6-4-5-7-20(17)26-21)13-16(25-22)14-24-11-10-23(2)3/h4-9,12-13H,10-11,14H2,1-3H3 |
| InChIKey | ZHXHKSSWMAZRHU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|