C21H22N2OS — CID 22478343
N,N-dimethyl-2-(3-thia-13-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethoxy)ethanamine (PubChem CID 22478343) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-thia-13-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethoxy)ethanamine.
| Compound Name | N,N-dimethyl-2-(3-thia-13-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethoxy)ethanamine |
|---|---|
| PubChem CID | 22478343 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N,N-dimethyl-2-(3-thia-13-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-ylmethoxy)ethanamine |
| SMILES | CN(C)CCOCc1cc2c(s1)-c1ccccc1Nc1ccccc1-2 |
| InChI | InChI=1S/C21H22N2OS/c1-23(2)11-12-24-14-15-13-18-16-7-3-5-9-19(16)22-20-10-6-4-8-17(20)21(18)25-15/h3-10,13,22H,11-12,14H2,1-2H3 |
| InChIKey | JBDIYIYYUSGDIJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|