About N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide
N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 22478764) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| PubChem CID | 22478764 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H17N3O3/c23-18-7-3-4-8-19(18)24-20(26)15-11-9-14(10-12-15)13-25-21(27)16-5-1-2-6-17(16)22(25)28/h1-12H,13,23H2,(H,24,26) |
| InChIKey | QPOXAHHWWQYERQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide?
The IUPAC name of N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (CID 22478764) is N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
What is the SMILES notation for N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide?
The canonical SMILES for N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide is Nc1ccccc1NC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide?
The InChIKey is QPOXAHHWWQYERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O3/c23-18-7-3-4-8-19(18)24-20(26)15-11-9-14(10-12-15)13-25-21(27)16-5-1-2-6-17(16)22(25)28/h1-12H,13,23H2,(H,24,26).
What are the key properties of N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide?
N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide has a molecular weight of 371.40 g/mol, XLogP of 3.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide is sourced from PubChem (CID 22478764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).