About 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione
6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione (PubChem CID 22479099) has the molecular formula C24H17F2NO2
and a molecular weight of 389.40 g/mol. Its IUPAC name is 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione.
Molecular Properties
| Compound Name | 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione |
| PubChem CID | 22479099 |
| Molecular Formula | C24H17F2NO2 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione |
| SMILES | CC1=C2C(C#Cc3ccccc3)C=CN2C(=O)C(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C24H17F2NO2/c1-15-22-18(9-7-16-5-3-2-4-6-16)11-12-27(22)24(29)19(23(15)28)13-17-8-10-20(25)21(26)14-17/h2-6,8,10-12,14,18-19H,13H2,1H3 |
| InChIKey | XYJSTQYBXVYHMH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione?
The IUPAC name of 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione (CID 22479099) is 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione.
What is the SMILES notation for 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione?
The canonical SMILES for 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione is CC1=C2C(C#Cc3ccccc3)C=CN2C(=O)C(Cc2ccc(F)c(F)c2)C1=O.
What is the InChIKey of 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione?
The InChIKey is XYJSTQYBXVYHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F2NO2/c1-15-22-18(9-7-16-5-3-2-4-6-16)11-12-27(22)24(29)19(23(15)28)13-17-8-10-20(25)21(26)14-17/h2-6,8,10-12,14,18-19H,13H2,1H3.
What are the key properties of 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione?
6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione has a molecular weight of 389.40 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-difluorophenyl)methyl]-8-methyl-1-(2-phenylethynyl)-1H-indolizine-5,7-dione is sourced from PubChem (CID 22479099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).