C23H37NO5Si — CID 22479157
2-O-benzyl 1-O-tert-butyl 4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 22479157) has the molecular formula C23H37NO5Si and a molecular weight of 435.64 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22479157 |
| Molecular Formula | C23H37NO5Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO5Si/c1-22(2,3)28-21(26)24-15-18(29-30(7,8)23(4,5)6)14-19(24)20(25)27-16-17-12-10-9-11-13-17/h9-13,18-19H,14-16H2,1-8H3 |
| InChIKey | BFXFQVBYYQVALC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|