About 5-amino-1,3-oxazolidin-2-one
5-amino-1,3-oxazolidin-2-one (PubChem CID 22479648) has the molecular formula C3H6N2O2
and a molecular weight of 102.09 g/mol. Its IUPAC name is 5-amino-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-amino-1,3-oxazolidin-2-one |
| PubChem CID | 22479648 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | 5-amino-1,3-oxazolidin-2-one |
| SMILES | NC1CNC(=O)O1 |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-5-3(6)7-2/h2H,1,4H2,(H,5,6) |
| InChIKey | RFPDIKCSEDYLKW-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-oxazolidin-2-one?
The IUPAC name of 5-amino-1,3-oxazolidin-2-one (CID 22479648) is 5-amino-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-amino-1,3-oxazolidin-2-one?
The canonical SMILES for 5-amino-1,3-oxazolidin-2-one is NC1CNC(=O)O1.
What is the InChIKey of 5-amino-1,3-oxazolidin-2-one?
The InChIKey is RFPDIKCSEDYLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2/c4-2-1-5-3(6)7-2/h2H,1,4H2,(H,5,6).
What are the key properties of 5-amino-1,3-oxazolidin-2-one?
5-amino-1,3-oxazolidin-2-one has a molecular weight of 102.09 g/mol, XLogP of -0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-oxazolidin-2-one is sourced from PubChem (CID 22479648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).