C47H39FN6O2 — CID 22479758
N-[(4-fluorophenyl)methyl]-3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]benzamide (PubChem CID 22479758) has the molecular formula C47H39FN6O2 and a molecular weight of 738.87 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 22479758 |
| Molecular Formula | C47H39FN6O2 |
| Molecular Weight | 738.87 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cccc(-c2nn(C3CCCCO3)c3ccc(-c4ncn(C(c5ccccc5)(c5ccccc5)c5ccccc5)n4)cc23)c1 |
| InChI | InChI=1S/C47H39FN6O2/c48-40-25-22-33(23-26-40)31-49-46(55)36-14-12-13-34(29-36)44-41-30-35(24-27-42(41)54(51-44)43-21-10-11-28-56-43)45-50-32-53(52-45)47(37-15-4-1-5-16-37,38-17-6-2-7-18-38)39-19-8-3-9-20-39/h1-9,12-20,22-27,29-30,32,43H,10-11,21,28,31H2,(H,49,55) |
| InChIKey | POZNYXPUONQJFL-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.87 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|