About 3-phenyl-1H-indazol-5-ol
3-phenyl-1H-indazol-5-ol (PubChem CID 22479862) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-phenyl-1H-indazol-5-ol.
Molecular Properties
| Compound Name | 3-phenyl-1H-indazol-5-ol |
| PubChem CID | 22479862 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-phenyl-1H-indazol-5-ol |
| SMILES | Oc1ccc2[nH]nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C13H10N2O/c16-10-6-7-12-11(8-10)13(15-14-12)9-4-2-1-3-5-9/h1-8,16H,(H,14,15) |
| InChIKey | HQKURVUQIRIXNW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1H-indazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1H-indazol-5-ol?
The IUPAC name of 3-phenyl-1H-indazol-5-ol (CID 22479862) is 3-phenyl-1H-indazol-5-ol.
What is the SMILES notation for 3-phenyl-1H-indazol-5-ol?
The canonical SMILES for 3-phenyl-1H-indazol-5-ol is Oc1ccc2[nH]nc(-c3ccccc3)c2c1.
What is the InChIKey of 3-phenyl-1H-indazol-5-ol?
The InChIKey is HQKURVUQIRIXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c16-10-6-7-12-11(8-10)13(15-14-12)9-4-2-1-3-5-9/h1-8,16H,(H,14,15).
What are the key properties of 3-phenyl-1H-indazol-5-ol?
3-phenyl-1H-indazol-5-ol has a molecular weight of 210.24 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1H-indazol-5-ol is sourced from PubChem (CID 22479862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).