About N,N-dimethylmethanamine;N-methylmethanamine
N,N-dimethylmethanamine;N-methylmethanamine (PubChem CID 22481130) has the molecular formula C5H16N2
and a molecular weight of 104.20 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-methylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;N-methylmethanamine |
| PubChem CID | 22481130 |
| Molecular Formula | C5H16N2 |
| Molecular Weight | 104.20 g/mol |
| Exact Mass | 104.13 |
| IUPAC Name | N,N-dimethylmethanamine;N-methylmethanamine |
| SMILES | CN(C)C.CNC |
| InChI | InChI=1S/C3H9N.C2H7N/c1-4(2)3;1-3-2/h1-3H3;3H,1-2H3 |
| InChIKey | CXWXDKQTDFOTBT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;N-methylmethanamine?
The IUPAC name of N,N-dimethylmethanamine;N-methylmethanamine (CID 22481130) is N,N-dimethylmethanamine;N-methylmethanamine.
What is the SMILES notation for N,N-dimethylmethanamine;N-methylmethanamine?
The canonical SMILES for N,N-dimethylmethanamine;N-methylmethanamine is CN(C)C.CNC.
What is the InChIKey of N,N-dimethylmethanamine;N-methylmethanamine?
The InChIKey is CXWXDKQTDFOTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7N/c1-4(2)3;1-3-2/h1-3H3;3H,1-2H3.
What are the key properties of N,N-dimethylmethanamine;N-methylmethanamine?
N,N-dimethylmethanamine;N-methylmethanamine has a molecular weight of 104.20 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;N-methylmethanamine is sourced from PubChem (CID 22481130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).