C20H20ClN3OS — CID 22481236
N'-[4-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide (PubChem CID 22481236) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is N'-[4-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 22481236 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N'-[4-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(Oc2nc(-c3ccccc3Cl)cs2)c(C)cc1/N=C/N(C)C |
| InChI | InChI=1S/C20H20ClN3OS/c1-13-10-19(14(2)9-17(13)22-12-24(3)4)25-20-23-18(11-26-20)15-7-5-6-8-16(15)21/h5-12H,1-4H3/b22-12+ |
| InChIKey | FBPWELMUOHGIJX-WSDLNYQXSA-N |
| XLogP | 6.09 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|