About 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium
1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium (PubChem CID 22481312) has the molecular formula C26H24O5S2
and a molecular weight of 480.61 g/mol. Its IUPAC name is 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium |
| PubChem CID | 22481312 |
| Molecular Formula | C26H24O5S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium |
| SMILES | COC(=O)C1(S(=O)(=O)[O-])C=CC=CC1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H10O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13-7(9)8(14(10,11)12)5-3-2-4-6-8/h1-15H;2-5H,6H2,1H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | XWMCNSNNFCCBRR-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium?
The IUPAC name of 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium (CID 22481312) is 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium.
What is the SMILES notation for 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium?
The canonical SMILES for 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium is COC(=O)C1(S(=O)(=O)[O-])C=CC=CC1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium?
The InChIKey is XWMCNSNNFCCBRR-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C8H10O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13-7(9)8(14(10,11)12)5-3-2-4-6-8/h1-15H;2-5H,6H2,1H3,(H,10,11,12)/q+1;/p-1.
What are the key properties of 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium?
1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium has a molecular weight of 480.61 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxycarbonylcyclohexa-2,4-diene-1-sulfonate;triphenylsulfanium is sourced from PubChem (CID 22481312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).