About 2-fluorobenzenesulfonate;triphenylsulfanium
2-fluorobenzenesulfonate;triphenylsulfanium (PubChem CID 22481386) has the molecular formula C24H19FO3S2
and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-fluorobenzenesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-fluorobenzenesulfonate;triphenylsulfanium |
| PubChem CID | 22481386 |
| Molecular Formula | C24H19FO3S2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-fluorobenzenesulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])c1ccccc1F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C6H5FO3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-5-3-1-2-4-6(5)11(8,9)10/h1-15H;1-4H,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LUWDQUMXVZZFAQ-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzenesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzenesulfonate;triphenylsulfanium?
The IUPAC name of 2-fluorobenzenesulfonate;triphenylsulfanium (CID 22481386) is 2-fluorobenzenesulfonate;triphenylsulfanium.
What is the SMILES notation for 2-fluorobenzenesulfonate;triphenylsulfanium?
The canonical SMILES for 2-fluorobenzenesulfonate;triphenylsulfanium is O=S(=O)([O-])c1ccccc1F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-fluorobenzenesulfonate;triphenylsulfanium?
The InChIKey is LUWDQUMXVZZFAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C6H5FO3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-5-3-1-2-4-6(5)11(8,9)10/h1-15H;1-4H,(H,8,9,10)/q+1;/p-1.
What are the key properties of 2-fluorobenzenesulfonate;triphenylsulfanium?
2-fluorobenzenesulfonate;triphenylsulfanium has a molecular weight of 438.55 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzenesulfonate;triphenylsulfanium is sourced from PubChem (CID 22481386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).