About 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine
2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine (PubChem CID 22482026) has the molecular formula C15H16Cl2N4O
and a molecular weight of 339.23 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine.
Molecular Properties
| Compound Name | 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine |
| PubChem CID | 22482026 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine |
| SMILES | Clc1cc(Cl)cc(COc2cncc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C15H16Cl2N4O/c16-12-5-11(6-13(17)7-12)10-22-15-9-19-8-14(20-15)21-3-1-18-2-4-21/h5-9,18H,1-4,10H2 |
| InChIKey | GBFQXJFIYTXKAD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine?
The IUPAC name of 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine (CID 22482026) is 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine.
What is the SMILES notation for 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine?
The canonical SMILES for 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine is Clc1cc(Cl)cc(COc2cncc(N3CCNCC3)n2)c1.
What is the InChIKey of 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine?
The InChIKey is GBFQXJFIYTXKAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N4O/c16-12-5-11(6-13(17)7-12)10-22-15-9-19-8-14(20-15)21-3-1-18-2-4-21/h5-9,18H,1-4,10H2.
What are the key properties of 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine?
2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine has a molecular weight of 339.23 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine is sourced from PubChem (CID 22482026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).