C15H16Cl2N4O — CID 22482026
2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine (PubChem CID 22482026) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine.
| Compound Name | 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine |
|---|---|
| PubChem CID | 22482026 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methoxy]-6-piperazin-1-ylpyrazine |
| SMILES | Clc1cc(Cl)cc(COc2cncc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C15H16Cl2N4O/c16-12-5-11(6-13(17)7-12)10-22-15-9-19-8-14(20-15)21-3-1-18-2-4-21/h5-9,18H,1-4,10H2 |
| InChIKey | GBFQXJFIYTXKAD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |