C7H9FO — CID 22482457
1-fluoro-5-methoxycyclohexa-1,3-diene (PubChem CID 22482457) has the molecular formula C7H9FO and a molecular weight of 128.15 g/mol. Its IUPAC name is 1-fluoro-5-methoxycyclohexa-1,3-diene.
| Compound Name | 1-fluoro-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22482457 |
| Molecular Formula | C7H9FO |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1-fluoro-5-methoxycyclohexa-1,3-diene |
| SMILES | COC1C=CC=C(F)C1 |
| InChI | InChI=1S/C7H9FO/c1-9-7-4-2-3-6(8)5-7/h2-4,7H,5H2,1H3 |
| InChIKey | WDWXYGZLOLZLKQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |