About [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate
[2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate (PubChem CID 22482475) has the molecular formula C16H12F2N2O2
and a molecular weight of 302.28 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate.
Molecular Properties
| Compound Name | [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate |
| PubChem CID | 22482475 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1cccc2[nH]c(-c3c(F)cccc3F)nc12 |
| InChI | InChI=1S/C16H12F2N2O2/c1-9(21)22-8-10-4-2-7-13-15(10)20-16(19-13)14-11(17)5-3-6-12(14)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | UGZCQTSMFQPMSJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate?
The IUPAC name of [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate (CID 22482475) is [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate.
What is the SMILES notation for [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate?
The canonical SMILES for [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate is CC(=O)OCc1cccc2[nH]c(-c3c(F)cccc3F)nc12.
What is the InChIKey of [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate?
The InChIKey is UGZCQTSMFQPMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O2/c1-9(21)22-8-10-4-2-7-13-15(10)20-16(19-13)14-11(17)5-3-6-12(14)18/h2-7H,8H2,1H3,(H,19,20).
What are the key properties of [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate?
[2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate has a molecular weight of 302.28 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-difluorophenyl)-1H-benzimidazol-4-yl]methyl acetate is sourced from PubChem (CID 22482475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).