About 2-methyl-1,1-dipropylhydrazine
2-methyl-1,1-dipropylhydrazine (PubChem CID 22482553) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is 2-methyl-1,1-dipropylhydrazine.
Molecular Properties
| Compound Name | 2-methyl-1,1-dipropylhydrazine |
| PubChem CID | 22482553 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 2-methyl-1,1-dipropylhydrazine |
| SMILES | CCCN(CCC)NC |
| InChI | InChI=1S/C7H18N2/c1-4-6-9(8-3)7-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | YJSGNHSYRAKFFB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,1-dipropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,1-dipropylhydrazine?
The IUPAC name of 2-methyl-1,1-dipropylhydrazine (CID 22482553) is 2-methyl-1,1-dipropylhydrazine.
What is the SMILES notation for 2-methyl-1,1-dipropylhydrazine?
The canonical SMILES for 2-methyl-1,1-dipropylhydrazine is CCCN(CCC)NC.
What is the InChIKey of 2-methyl-1,1-dipropylhydrazine?
The InChIKey is YJSGNHSYRAKFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2/c1-4-6-9(8-3)7-5-2/h8H,4-7H2,1-3H3.
What are the key properties of 2-methyl-1,1-dipropylhydrazine?
2-methyl-1,1-dipropylhydrazine has a molecular weight of 130.23 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,1-dipropylhydrazine is sourced from PubChem (CID 22482553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).