C21H19Cl2NO — CID 22483117
1-(2,4-dichlorophenyl)-N-[(4-phenoxyphenyl)methyl]ethanamine (PubChem CID 22483117) has the molecular formula C21H19Cl2NO and a molecular weight of 372.30 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[(4-phenoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[(4-phenoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 22483117 |
| Molecular Formula | C21H19Cl2NO |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[(4-phenoxyphenyl)methyl]ethanamine |
| SMILES | CC(NCc1ccc(Oc2ccccc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19Cl2NO/c1-15(20-12-9-17(22)13-21(20)23)24-14-16-7-10-19(11-8-16)25-18-5-3-2-4-6-18/h2-13,15,24H,14H2,1H3 |
| InChIKey | MELMGXQOPNQRRV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |