C28H34ClN3O — CID 22484021
6-[4-(7-chloro-1H-indol-3-yl)piperidin-1-yl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)hexan-1-one (PubChem CID 22484021) has the molecular formula C28H34ClN3O and a molecular weight of 464.05 g/mol. Its IUPAC name is 6-[4-(7-chloro-1H-indol-3-yl)piperidin-1-yl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)hexan-1-one.
| Compound Name | 6-[4-(7-chloro-1H-indol-3-yl)piperidin-1-yl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 22484021 |
| Molecular Formula | C28H34ClN3O |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 6-[4-(7-chloro-1H-indol-3-yl)piperidin-1-yl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)hexan-1-one |
| SMILES | O=C(CCCCCN1CCC(c2c[nH]c3c(Cl)cccc23)CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H34ClN3O/c29-26-10-6-9-24-25(19-30-28(24)26)22-12-16-31(17-13-22)15-5-1-2-11-27(33)32-18-14-21-7-3-4-8-23(21)20-32/h3-4,6-10,19,22,30H,1-2,5,11-18,20H2 |
| InChIKey | IQYUCUOHMQQYTE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|