C25H32N4O2SSi — CID 22484560
2-[7-(benzenesulfonyl)-4-piperidin-1-ylpyrrolo[2,3-d]pyrimidin-5-yl]ethynyl-triethylsilane (PubChem CID 22484560) has the molecular formula C25H32N4O2SSi and a molecular weight of 480.71 g/mol. Its IUPAC name is 2-[7-(benzenesulfonyl)-4-piperidin-1-ylpyrrolo[2,3-d]pyrimidin-5-yl]ethynyl-triethylsilane.
| Compound Name | 2-[7-(benzenesulfonyl)-4-piperidin-1-ylpyrrolo[2,3-d]pyrimidin-5-yl]ethynyl-triethylsilane |
|---|---|
| PubChem CID | 22484560 |
| Molecular Formula | C25H32N4O2SSi |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-[7-(benzenesulfonyl)-4-piperidin-1-ylpyrrolo[2,3-d]pyrimidin-5-yl]ethynyl-triethylsilane |
| SMILES | CC[Si](C#Cc1cn(S(=O)(=O)c2ccccc2)c2ncnc(N3CCCCC3)c12)(CC)CC |
| InChI | InChI=1S/C25H32N4O2SSi/c1-4-33(5-2,6-3)18-15-21-19-29(32(30,31)22-13-9-7-10-14-22)25-23(21)24(26-20-27-25)28-16-11-8-12-17-28/h7,9-10,13-14,19-20H,4-6,8,11-12,16-17H2,1-3H3 |
| InChIKey | SDKRBHLJRLGGMA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|