C35H28N2O6 — CID 22484939
2-[[2-[4-[4-[(3-benzamidophenyl)methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid (PubChem CID 22484939) has the molecular formula C35H28N2O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is 2-[[2-[4-[4-[(3-benzamidophenyl)methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-[(3-benzamidophenyl)methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22484939 |
| Molecular Formula | C35H28N2O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-[[2-[4-[4-[(3-benzamidophenyl)methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc(OCc3cccc(NC(=O)c4ccccc4)c3)cc2)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C35H28N2O6/c38-33(37-32-12-5-4-11-31(32)35(40)41)22-24-13-15-29(16-14-24)43-30-19-17-28(18-20-30)42-23-25-7-6-10-27(21-25)36-34(39)26-8-2-1-3-9-26/h1-21H,22-23H2,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | YKBUMXFDVCYGEI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |