C33H45N5O5S — CID 22485381
1-cyclopropyl-4-[4-[4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide (PubChem CID 22485381) has the molecular formula C33H45N5O5S and a molecular weight of 623.82 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[4-[4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22485381 |
| Molecular Formula | C33H45N5O5S |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 1-cyclopropyl-4-[4-[4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C3CCN(c4ccc(S(=O)(=O)C5(C(=O)NO)CCN(C6CC6)CC5)cc4)CC3)CC2)c1C |
| InChI | InChI=1S/C33H45N5O5S/c1-24-4-3-5-30(25(24)2)37-20-22-38(23-21-37)31(39)26-12-16-35(17-13-26)28-8-10-29(11-9-28)44(42,43)33(32(40)34-41)14-18-36(19-15-33)27-6-7-27/h3-5,8-11,26-27,41H,6-7,12-23H2,1-2H3,(H,34,40) |
| InChIKey | HWZVYNMATDDRGV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|