C34H36F6N4O6 — CID 22485489
N,N'-bis[6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]-3-pyridinyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 22485489) has the molecular formula C34H36F6N4O6 and a molecular weight of 710.67 g/mol. Its IUPAC name is N,N'-bis[6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]-3-pyridinyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis[6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]-3-pyridinyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 22485489 |
| Molecular Formula | C34H36F6N4O6 |
| Molecular Weight | 710.67 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | N,N'-bis[6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]-3-pyridinyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | COc1cc(-c2ccc(N(C)CCN(C)c3ccc(-c4cc(OC)c(OCC(F)(F)F)c(OC)c4)nc3)cn2)cc(OC)c1OCC(F)(F)F |
| InChI | InChI=1S/C34H36F6N4O6/c1-43(23-7-9-25(41-17-23)21-13-27(45-3)31(28(14-21)46-4)49-19-33(35,36)37)11-12-44(2)24-8-10-26(42-18-24)22-15-29(47-5)32(30(16-22)48-6)50-20-34(38,39)40/h7-10,13-18H,11-12,19-20H2,1-6H3 |
| InChIKey | OQKXFELXGDACJC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |