(4-fluoro-3,5-dimethoxyphenyl)boronic acid

C8H10BFO4 — CID 22485600

IUPAC(4-fluoro-3,5-dimethoxyphenyl)boronic acid
SMILESCOc1cc(B(O)O)cc(OC)c1F
InChIInChI=1S/C8H10BFO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3
InChIKeyYXCHYZQCQRCTOC-UHFFFAOYSA-N
MW199.97 g/mol
LogP-0.48
Rot. Bonds3

About (4-fluoro-3,5-dimethoxyphenyl)boronic acid

(4-fluoro-3,5-dimethoxyphenyl)boronic acid (PubChem CID 22485600) has the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethoxyphenyl)boronic acid.

Molecular Properties

Compound Name(4-fluoro-3,5-dimethoxyphenyl)boronic acid
PubChem CID22485600
Molecular FormulaC8H10BFO4
Molecular Weight199.97 g/mol
Exact Mass200.07
IUPAC Name(4-fluoro-3,5-dimethoxyphenyl)boronic acid
SMILESCOc1cc(B(O)O)cc(OC)c1F
InChIInChI=1S/C8H10BFO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3
InChIKeyYXCHYZQCQRCTOC-UHFFFAOYSA-N
XLogP-0.48
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.97
LogP ≤ 5-0.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-fluoro-3,5-dimethoxyphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The IUPAC name of (4-fluoro-3,5-dimethoxyphenyl)boronic acid (CID 22485600) is (4-fluoro-3,5-dimethoxyphenyl)boronic acid.
What is the SMILES notation for (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The canonical SMILES for (4-fluoro-3,5-dimethoxyphenyl)boronic acid is COc1cc(B(O)O)cc(OC)c1F.
What is the InChIKey of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The InChIKey is YXCHYZQCQRCTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BFO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3.
What are the key properties of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
(4-fluoro-3,5-dimethoxyphenyl)boronic acid has a molecular weight of 199.97 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-3,5-dimethoxyphenyl)boronic acid is sourced from PubChem (CID 22485600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).