About (4-fluoro-3,5-dimethoxyphenyl)boronic acid
(4-fluoro-3,5-dimethoxyphenyl)boronic acid (PubChem CID 22485600) has the molecular formula C8H10BFO4
and a molecular weight of 199.97 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethoxyphenyl)boronic acid.
Molecular Properties
| Compound Name | (4-fluoro-3,5-dimethoxyphenyl)boronic acid |
| PubChem CID | 22485600 |
| Molecular Formula | C8H10BFO4 |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4-fluoro-3,5-dimethoxyphenyl)boronic acid |
| SMILES | COc1cc(B(O)O)cc(OC)c1F |
| InChI | InChI=1S/C8H10BFO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3 |
| InChIKey | YXCHYZQCQRCTOC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-3,5-dimethoxyphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The IUPAC name of (4-fluoro-3,5-dimethoxyphenyl)boronic acid (CID 22485600) is (4-fluoro-3,5-dimethoxyphenyl)boronic acid.
What is the SMILES notation for (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The canonical SMILES for (4-fluoro-3,5-dimethoxyphenyl)boronic acid is COc1cc(B(O)O)cc(OC)c1F.
What is the InChIKey of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
The InChIKey is YXCHYZQCQRCTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BFO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3.
What are the key properties of (4-fluoro-3,5-dimethoxyphenyl)boronic acid?
(4-fluoro-3,5-dimethoxyphenyl)boronic acid has a molecular weight of 199.97 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-3,5-dimethoxyphenyl)boronic acid is sourced from PubChem (CID 22485600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).