About 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine
3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 22486048) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
Molecular Properties
| Compound Name | 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| PubChem CID | 22486048 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCC1COc2cscc2O1 |
| InChI | InChI=1S/C8H10O2S/c1-2-6-3-9-7-4-11-5-8(7)10-6/h4-6H,2-3H2,1H3 |
| InChIKey | USEHYZSWYYJCHO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The IUPAC name of 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (CID 22486048) is 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the SMILES notation for 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The canonical SMILES for 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is CCC1COc2cscc2O1.
What is the InChIKey of 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The InChIKey is USEHYZSWYYJCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-2-6-3-9-7-4-11-5-8(7)10-6/h4-6H,2-3H2,1H3.
What are the key properties of 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine has a molecular weight of 170.23 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is sourced from PubChem (CID 22486048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).