C23H19F3N2O2 — CID 22486103
1',3',3'-trimethyl-5'-(trifluoromethoxy)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 22486103) has the molecular formula C23H19F3N2O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is 1',3',3'-trimethyl-5'-(trifluoromethoxy)spiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 1',3',3'-trimethyl-5'-(trifluoromethoxy)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 22486103 |
| Molecular Formula | C23H19F3N2O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1',3',3'-trimethyl-5'-(trifluoromethoxy)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | CN1c2ccc(OC(F)(F)F)cc2C(C)(C)C12C=Nc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C23H19F3N2O2/c1-21(2)17-12-15(29-23(24,25)26)9-10-18(17)28(3)22(21)13-27-20-16-7-5-4-6-14(16)8-11-19(20)30-22/h4-13H,1-3H3 |
| InChIKey | ZBBGPMFUWGKXTM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|