About 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one (PubChem CID 22486192) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one.
Molecular Properties
| Compound Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one |
| PubChem CID | 22486192 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1nc2ncccc2o1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-3-4-6-9(15)12-14-11-10(16-12)7-5-8-13-11/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | WMXFCLKQEVMEKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one?
The IUPAC name of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one (CID 22486192) is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one.
What is the SMILES notation for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one?
The canonical SMILES for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one is CCCCCC(=O)c1nc2ncccc2o1.
What is the InChIKey of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one?
The InChIKey is WMXFCLKQEVMEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-2-3-4-6-9(15)12-14-11-10(16-12)7-5-8-13-11/h5,7-8H,2-4,6H2,1H3.
What are the key properties of 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one?
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one has a molecular weight of 218.26 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)hexan-1-one is sourced from PubChem (CID 22486192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).