C19H10F6O8 — CID 22486372
3-[1-(2,3-dicarboxyphenyl)-1,2,2,3,3,3-hexafluoropropyl]phthalic acid (PubChem CID 22486372) has the molecular formula C19H10F6O8 and a molecular weight of 480.27 g/mol. Its IUPAC name is 3-[1-(2,3-dicarboxyphenyl)-1,2,2,3,3,3-hexafluoropropyl]phthalic acid.
| Compound Name | 3-[1-(2,3-dicarboxyphenyl)-1,2,2,3,3,3-hexafluoropropyl]phthalic acid |
|---|---|
| PubChem CID | 22486372 |
| Molecular Formula | C19H10F6O8 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 3-[1-(2,3-dicarboxyphenyl)-1,2,2,3,3,3-hexafluoropropyl]phthalic acid |
| SMILES | O=C(O)c1cccc(C(F)(c2cccc(C(=O)O)c2C(=O)O)C(F)(F)C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C19H10F6O8/c20-17(18(21,22)19(23,24)25,9-5-1-3-7(13(26)27)11(9)15(30)31)10-6-2-4-8(14(28)29)12(10)16(32)33/h1-6H,(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | FHOGZZXYUFKXIU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|