C20H11F9O7 — CID 22486584
5-(2,5-dioxooxolan-3-yl)-8-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 22486584) has the molecular formula C20H11F9O7 and a molecular weight of 534.28 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-8-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-8-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 22486584 |
| Molecular Formula | C20H11F9O7 |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-8-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3cc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc32)C(=O)O1 |
| InChI | InChI=1S/C20H11F9O7/c21-17(22,19(25,26)27)18(23,24)20(28,29)36-6-1-2-7-8(10-5-12(30)34-14(10)31)4-11-13(9(7)3-6)16(33)35-15(11)32/h1-3,8,10-11,13H,4-5H2 |
| InChIKey | CGRZBJWSTCDTCO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|