About 2-N-fluorobenzene-1,2-diamine
2-N-fluorobenzene-1,2-diamine (PubChem CID 22486709) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is 2-N-fluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-fluorobenzene-1,2-diamine |
| PubChem CID | 22486709 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 2-N-fluorobenzene-1,2-diamine |
| SMILES | Nc1ccccc1NF |
| InChI | InChI=1S/C6H7FN2/c7-9-6-4-2-1-3-5(6)8/h1-4,9H,8H2 |
| InChIKey | LFQKIPWZIYUJLP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-N-fluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-fluorobenzene-1,2-diamine?
The IUPAC name of 2-N-fluorobenzene-1,2-diamine (CID 22486709) is 2-N-fluorobenzene-1,2-diamine.
What is the SMILES notation for 2-N-fluorobenzene-1,2-diamine?
The canonical SMILES for 2-N-fluorobenzene-1,2-diamine is Nc1ccccc1NF.
What is the InChIKey of 2-N-fluorobenzene-1,2-diamine?
The InChIKey is LFQKIPWZIYUJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2/c7-9-6-4-2-1-3-5(6)8/h1-4,9H,8H2.
What are the key properties of 2-N-fluorobenzene-1,2-diamine?
2-N-fluorobenzene-1,2-diamine has a molecular weight of 126.13 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-fluorobenzene-1,2-diamine is sourced from PubChem (CID 22486709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).