About N,N-di(cyclopenta-1,3-dien-1-yl)formamide
N,N-di(cyclopenta-1,3-dien-1-yl)formamide (PubChem CID 22486733) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is N,N-di(cyclopenta-1,3-dien-1-yl)formamide.
Molecular Properties
| Compound Name | N,N-di(cyclopenta-1,3-dien-1-yl)formamide |
| PubChem CID | 22486733 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N,N-di(cyclopenta-1,3-dien-1-yl)formamide |
| SMILES | O=CN(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C11H11NO/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h1-5,7,9H,6,8H2 |
| InChIKey | PRAREEHLGTXFIK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-di(cyclopenta-1,3-dien-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(cyclopenta-1,3-dien-1-yl)formamide?
The IUPAC name of N,N-di(cyclopenta-1,3-dien-1-yl)formamide (CID 22486733) is N,N-di(cyclopenta-1,3-dien-1-yl)formamide.
What is the SMILES notation for N,N-di(cyclopenta-1,3-dien-1-yl)formamide?
The canonical SMILES for N,N-di(cyclopenta-1,3-dien-1-yl)formamide is O=CN(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of N,N-di(cyclopenta-1,3-dien-1-yl)formamide?
The InChIKey is PRAREEHLGTXFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h1-5,7,9H,6,8H2.
What are the key properties of N,N-di(cyclopenta-1,3-dien-1-yl)formamide?
N,N-di(cyclopenta-1,3-dien-1-yl)formamide has a molecular weight of 173.22 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(cyclopenta-1,3-dien-1-yl)formamide is sourced from PubChem (CID 22486733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).