C17H16ClF3N2O5 — CID 22489916
3-[2-chloro-5-(trifluoromethyl)phenoxy]-3-pyridin-3-ylpropan-1-amine;oxalic acid (PubChem CID 22489916) has the molecular formula C17H16ClF3N2O5 and a molecular weight of 420.77 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenoxy]-3-pyridin-3-ylpropan-1-amine;oxalic acid.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenoxy]-3-pyridin-3-ylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 22489916 |
| Molecular Formula | C17H16ClF3N2O5 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenoxy]-3-pyridin-3-ylpropan-1-amine;oxalic acid |
| SMILES | NCCC(Oc1cc(C(F)(F)F)ccc1Cl)c1cccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H14ClF3N2O.C2H2O4/c16-12-4-3-11(15(17,18)19)8-14(12)22-13(5-6-20)10-2-1-7-21-9-10;3-1(4)2(5)6/h1-4,7-9,13H,5-6,20H2;(H,3,4)(H,5,6) |
| InChIKey | DFPXBABCGUXOBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|