About 1-iodo-1-phenylhydrazine
1-iodo-1-phenylhydrazine (PubChem CID 22490354) has the molecular formula C6H7IN2
and a molecular weight of 234.04 g/mol. Its IUPAC name is 1-iodo-1-phenylhydrazine.
Molecular Properties
| Compound Name | 1-iodo-1-phenylhydrazine |
| PubChem CID | 22490354 |
| Molecular Formula | C6H7IN2 |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 1-iodo-1-phenylhydrazine |
| SMILES | NN(I)c1ccccc1 |
| InChI | InChI=1S/C6H7IN2/c7-9(8)6-4-2-1-3-5-6/h1-5H,8H2 |
| InChIKey | ZSMYQOLRXYTBIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1-phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1-phenylhydrazine?
The IUPAC name of 1-iodo-1-phenylhydrazine (CID 22490354) is 1-iodo-1-phenylhydrazine.
What is the SMILES notation for 1-iodo-1-phenylhydrazine?
The canonical SMILES for 1-iodo-1-phenylhydrazine is NN(I)c1ccccc1.
What is the InChIKey of 1-iodo-1-phenylhydrazine?
The InChIKey is ZSMYQOLRXYTBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2/c7-9(8)6-4-2-1-3-5-6/h1-5H,8H2.
What are the key properties of 1-iodo-1-phenylhydrazine?
1-iodo-1-phenylhydrazine has a molecular weight of 234.04 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1-phenylhydrazine is sourced from PubChem (CID 22490354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).