C28H36BrFO3 — CID 22490783
(2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3,8-dimethylnona-2,4,6-trienoic acid (PubChem CID 22490783) has the molecular formula C28H36BrFO3 and a molecular weight of 519.50 g/mol. Its IUPAC name is (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3,8-dimethylnona-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3,8-dimethylnona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 22490783 |
| Molecular Formula | C28H36BrFO3 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3,8-dimethylnona-2,4,6-trienoic acid |
| SMILES | CCOc1c(/C(=C(F)\C=C\C(C)=C\C(=O)O)C(C)C)cc2c(c1Br)C(C)(C)CC=C2C(C)C |
| InChI | InChI=1S/C28H36BrFO3/c1-9-33-27-21(24(17(4)5)22(30)11-10-18(6)14-23(31)32)15-20-19(16(2)3)12-13-28(7,8)25(20)26(27)29/h10-12,14-17H,9,13H2,1-8H3,(H,31,32)/b11-10+,18-14+,24-22+ |
| InChIKey | YPAKWXUIBGZRHQ-JZHQBDKPSA-N |
| XLogP | 8.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|