C25H34N2O5 — CID 22491226
[2-[3-amino-4-(dimethylamino)phenyl]-4-methoxycyclohexyl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 22491226) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is [2-[3-amino-4-(dimethylamino)phenyl]-4-methoxycyclohexyl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [2-[3-amino-4-(dimethylamino)phenyl]-4-methoxycyclohexyl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22491226 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [2-[3-amino-4-(dimethylamino)phenyl]-4-methoxycyclohexyl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)C2CCC(OC)CC2c2ccc(N(C)C)c(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H34N2O5/c1-27(2)21-10-7-15(11-20(21)26)19-14-17(29-3)8-9-18(19)24(28)16-12-22(30-4)25(32-6)23(13-16)31-5/h7,10-13,17-19H,8-9,14,26H2,1-6H3 |
| InChIKey | BAFMHSISOBKVCY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|