C23H26FN3O3 — CID 22491435
[3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methanol (PubChem CID 22491435) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methanol.
| Compound Name | [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 22491435 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methanol |
| SMILES | OCc1cccc(OCC2CCC3CN(c4noc5ccc(F)cc45)CCN3C2)c1 |
| InChI | InChI=1S/C23H26FN3O3/c24-18-5-7-22-21(11-18)23(25-30-22)27-9-8-26-12-17(4-6-19(26)13-27)15-29-20-3-1-2-16(10-20)14-28/h1-3,5,7,10-11,17,19,28H,4,6,8-9,12-15H2 |
| InChIKey | SFEUFYDVHRXBRS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |