C24H28FN3O5S — CID 22491436
[3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methyl methanesulfonate (PubChem CID 22491436) has the molecular formula C24H28FN3O5S and a molecular weight of 489.57 g/mol. Its IUPAC name is [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methyl methanesulfonate.
| Compound Name | [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 22491436 |
| Molecular Formula | C24H28FN3O5S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [3-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]phenyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cccc(OCC2CCC3CN(c4noc5ccc(F)cc45)CCN3C2)c1 |
| InChI | InChI=1S/C24H28FN3O5S/c1-34(29,30)32-16-17-3-2-4-21(11-17)31-15-18-5-7-20-14-28(10-9-27(20)13-18)24-22-12-19(25)6-8-23(22)33-26-24/h2-4,6,8,11-12,18,20H,5,7,9-10,13-16H2,1H3 |
| InChIKey | JILIGKUDNYUYCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|