About 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine
1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 22491506) has the molecular formula C15H39NO3Si3
and a molecular weight of 365.74 g/mol. Its IUPAC name is 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine.
Molecular Properties
| Compound Name | 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| PubChem CID | 22491506 |
| Molecular Formula | C15H39NO3Si3 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CCO[Si](OCC)(OCC)C(CC)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H39NO3Si3/c1-11-15(16(20(5,6)7)21(8,9)10)22(17-12-2,18-13-3)19-14-4/h15H,11-14H2,1-10H3 |
| InChIKey | SLUBWLJMWHBKET-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The IUPAC name of 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (CID 22491506) is 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine.
What is the SMILES notation for 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The canonical SMILES for 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine is CCO[Si](OCC)(OCC)C(CC)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The InChIKey is SLUBWLJMWHBKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H39NO3Si3/c1-11-15(16(20(5,6)7)21(8,9)10)22(17-12-2,18-13-3)19-14-4/h15H,11-14H2,1-10H3.
What are the key properties of 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine has a molecular weight of 365.74 g/mol, XLogP of 4.32, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine is sourced from PubChem (CID 22491506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).