About 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine
1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 22491534) has the molecular formula C14H37NO3Si3
and a molecular weight of 351.71 g/mol. Its IUPAC name is 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine.
Molecular Properties
| Compound Name | 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine |
| PubChem CID | 22491534 |
| Molecular Formula | C14H37NO3Si3 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | CCO[Si](OCC)(OCC)C(C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H37NO3Si3/c1-11-16-21(17-12-2,18-13-3)14(4)15(19(5,6)7)20(8,9)10/h14H,11-13H2,1-10H3 |
| InChIKey | LVKICJPMMBKXNA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The IUPAC name of 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine (CID 22491534) is 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine.
What is the SMILES notation for 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The canonical SMILES for 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine is CCO[Si](OCC)(OCC)C(C)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The InChIKey is LVKICJPMMBKXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H37NO3Si3/c1-11-16-21(17-12-2,18-13-3)14(4)15(19(5,6)7)20(8,9)10/h14H,11-13H2,1-10H3.
What are the key properties of 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine has a molecular weight of 351.71 g/mol, XLogP of 3.93, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triethoxysilyl-N,N-bis(trimethylsilyl)ethanamine is sourced from PubChem (CID 22491534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).