C20H42O6 — CID 22491576
1,2,5-tris(tert-butylperoxy)-2,5-dimethylhexane (PubChem CID 22491576) has the molecular formula C20H42O6 and a molecular weight of 378.55 g/mol. Its IUPAC name is 1,2,5-tris(tert-butylperoxy)-2,5-dimethylhexane.
| Compound Name | 1,2,5-tris(tert-butylperoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 22491576 |
| Molecular Formula | C20H42O6 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 1,2,5-tris(tert-butylperoxy)-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOCC(C)(CCC(C)(C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C20H42O6/c1-16(2,3)22-21-15-20(12,26-24-18(7,8)9)14-13-19(10,11)25-23-17(4,5)6/h13-15H2,1-12H3 |
| InChIKey | ZGWYZROGCVTGMA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|