About ethoxyethane;methyl prop-2-enoate
ethoxyethane;methyl prop-2-enoate (PubChem CID 22491622) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is ethoxyethane;methyl prop-2-enoate.
Molecular Properties
| Compound Name | ethoxyethane;methyl prop-2-enoate |
| PubChem CID | 22491622 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | ethoxyethane;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CCOCC |
| InChI | InChI=1S/C4H6O2.C4H10O/c1-3-4(5)6-2;1-3-5-4-2/h3H,1H2,2H3;3-4H2,1-2H3 |
| InChIKey | DOMLXBPXLNDFAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;methyl prop-2-enoate?
The IUPAC name of ethoxyethane;methyl prop-2-enoate (CID 22491622) is ethoxyethane;methyl prop-2-enoate.
What is the SMILES notation for ethoxyethane;methyl prop-2-enoate?
The canonical SMILES for ethoxyethane;methyl prop-2-enoate is C=CC(=O)OC.CCOCC.
What is the InChIKey of ethoxyethane;methyl prop-2-enoate?
The InChIKey is DOMLXBPXLNDFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C4H10O/c1-3-4(5)6-2;1-3-5-4-2/h3H,1H2,2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;methyl prop-2-enoate?
ethoxyethane;methyl prop-2-enoate has a molecular weight of 160.21 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;methyl prop-2-enoate is sourced from PubChem (CID 22491622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).