C15H9NO2 — CID 22491669
8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17),14-heptaen-16-one (PubChem CID 22491669) has the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. Its IUPAC name is 8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17),14-heptaen-16-one.
| Compound Name | 8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17),14-heptaen-16-one |
|---|---|
| PubChem CID | 22491669 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17),14-heptaen-16-one |
| SMILES | O=C1N=Cc2cccc3c2C1c1ccccc1O3 |
| InChI | InChI=1S/C15H9NO2/c17-15-14-10-5-1-2-6-11(10)18-12-7-3-4-9(8-16-15)13(12)14/h1-8,14H |
| InChIKey | MYSVZFVVRSLJCN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |